C22H20F2N2O2 — CID 31361414
2-cyclopropyl-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-4-carboxamide (PubChem CID 31361414) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 31361414 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-cyclopropyl-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-4-carboxamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H20F2N2O2/c1-26(13-14-6-10-16(11-7-14)28-22(23)24)21(27)18-12-20(15-8-9-15)25-19-5-3-2-4-17(18)19/h2-7,10-12,15,22H,8-9,13H2,1H3 |
| InChIKey | BZQGOVXWVJDJND-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |