C19H15ClF2N2O2 — CID 55875327
6-chloro-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-8-carboxamide (PubChem CID 55875327) has the molecular formula C19H15ClF2N2O2 and a molecular weight of 376.79 g/mol. Its IUPAC name is 6-chloro-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-8-carboxamide.
| Compound Name | 6-chloro-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-8-carboxamide |
|---|---|
| PubChem CID | 55875327 |
| Molecular Formula | C19H15ClF2N2O2 |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-chloro-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylquinoline-8-carboxamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)c1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C19H15ClF2N2O2/c1-24(11-12-4-6-15(7-5-12)26-19(21)22)18(25)16-10-14(20)9-13-3-2-8-23-17(13)16/h2-10,19H,11H2,1H3 |
| InChIKey | WXBYBLHSMLUYFE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |