C23H27ClF3N5O2 — CID 31372423
(2R)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 31372423) has the molecular formula C23H27ClF3N5O2 and a molecular weight of 497.95 g/mol. Its IUPAC name is (2R)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 31372423 |
| Molecular Formula | C23H27ClF3N5O2 |
| Molecular Weight | 497.95 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (2R)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(N2CCOCC2)cc1)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C23H27ClF3N5O2/c1-16(22(33)29-18-2-4-19(5-3-18)31-10-12-34-13-11-31)30-6-8-32(9-7-30)21-20(24)14-17(15-28-21)23(25,26)27/h2-5,14-16H,6-13H2,1H3,(H,29,33)/t16-/m1/s1 |
| InChIKey | AXYBQTBLMOXOTF-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|