C18H18Cl2F3N5O — CID 46560926
N-(2-chloro-3-pyridinyl)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide (PubChem CID 46560926) has the molecular formula C18H18Cl2F3N5O and a molecular weight of 448.28 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46560926 |
| Molecular Formula | C18H18Cl2F3N5O |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1cccnc1Cl)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C18H18Cl2F3N5O/c1-11(17(29)26-14-3-2-4-24-15(14)20)27-5-7-28(8-6-27)16-13(19)9-12(10-25-16)18(21,22)23/h2-4,9-11H,5-8H2,1H3,(H,26,29) |
| InChIKey | PWJXRZMFZCZYOE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|