C19H21BrN4O3 — CID 31378107
4-[[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide (PubChem CID 31378107) has the molecular formula C19H21BrN4O3 and a molecular weight of 433.31 g/mol. Its IUPAC name is 4-[[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 31378107 |
| Molecular Formula | C19H21BrN4O3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]acetyl]amino]benzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H21BrN4O3/c1-12-9-14(20)5-8-16(12)23-18(26)11-24(2)10-17(25)22-15-6-3-13(4-7-15)19(21)27/h3-9H,10-11H2,1-2H3,(H2,21,27)(H,22,25)(H,23,26) |
| InChIKey | RUXWOUKEVLTFPX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |