C21H25BrN4O3 — CID 36639429
4-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide (PubChem CID 36639429) has the molecular formula C21H25BrN4O3 and a molecular weight of 461.36 g/mol. Its IUPAC name is 4-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide.
| Compound Name | 4-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 36639429 |
| Molecular Formula | C21H25BrN4O3 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 4-[3-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)CC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C21H25BrN4O3/c1-3-26(13-20(28)25-18-9-6-16(22)12-14(18)2)11-10-19(27)24-17-7-4-15(5-8-17)21(23)29/h4-9,12H,3,10-11,13H2,1-2H3,(H2,23,29)(H,24,27)(H,25,28) |
| InChIKey | CZPBVMWIXHIMCG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |