C21H25ClN4O3 — CID 36638338
4-[3-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-ethylamino]propanoylamino]benzamide (PubChem CID 36638338) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-[3-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-ethylamino]propanoylamino]benzamide.
| Compound Name | 4-[3-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 36638338 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-[3-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)CC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN4O3/c1-2-26(14-20(28)24-13-16-5-3-4-6-18(16)22)12-11-19(27)25-17-9-7-15(8-10-17)21(23)29/h3-10H,2,11-14H2,1H3,(H2,23,29)(H,24,28)(H,25,27) |
| InChIKey | ZTWFPYBCVHFQNF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |