C23H28N4O4 — CID 24588858
3-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(4-acetylphenyl)propanamide (PubChem CID 24588858) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(4-acetylphenyl)propanamide.
| Compound Name | 3-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(4-acetylphenyl)propanamide |
|---|---|
| PubChem CID | 24588858 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-[[2-(4-acetamidoanilino)-2-oxoethyl]-ethylamino]-N-(4-acetylphenyl)propanamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(C)=O)cc1)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-4-27(14-13-22(30)25-20-7-5-18(6-8-20)16(2)28)15-23(31)26-21-11-9-19(10-12-21)24-17(3)29/h5-12H,4,13-15H2,1-3H3,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | GTKAUUSTJCCEGY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |