C22H28N4O3 — CID 36638223
4-[3-[[2-(3,4-dimethylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide (PubChem CID 36638223) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[3-[[2-(3,4-dimethylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide.
| Compound Name | 4-[3-[[2-(3,4-dimethylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 36638223 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-[3-[[2-(3,4-dimethylanilino)-2-oxoethyl]-ethylamino]propanoylamino]benzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)CC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-26(14-21(28)25-19-8-5-15(2)16(3)13-19)12-11-20(27)24-18-9-6-17(7-10-18)22(23)29/h5-10,13H,4,11-12,14H2,1-3H3,(H2,23,29)(H,24,27)(H,25,28) |
| InChIKey | YVAQDMXXPHFTGX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |