C19H22F2N2O5S — CID 31398138
4-(diethylsulfamoyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide (PubChem CID 31398138) has the molecular formula C19H22F2N2O5S and a molecular weight of 428.46 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 31398138 |
| Molecular Formula | C19H22F2N2O5S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2ccc(OC)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C19H22F2N2O5S/c1-4-23(5-2)29(25,26)15-9-6-13(7-10-15)18(24)22-14-8-11-16(27-3)17(12-14)28-19(20)21/h6-12,19H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | RQLLWAFOVQZEKB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |