C27H29FN2O6 — CID 31400150
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (E)-3-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]prop-2-enoate (PubChem CID 31400150) has the molecular formula C27H29FN2O6 and a molecular weight of 496.54 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (E)-3-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]prop-2-enoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (E)-3-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 31400150 |
| Molecular Formula | C27H29FN2O6 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] (E)-3-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)NC2(C#N)CCCC2)ccc1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C27H29FN2O6/c1-2-33-24-17-20(5-11-23(24)35-16-15-34-22-9-7-21(28)8-10-22)6-12-26(32)36-18-25(31)30-27(19-29)13-3-4-14-27/h5-12,17H,2-4,13-16,18H2,1H3,(H,30,31)/b12-6+ |
| InChIKey | MWRBKFUIUPNDGU-WUXMJOGZSA-N |
| XLogP | 4.19 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|