C21H25N3O5S — CID 31403115
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate (PubChem CID 31403115) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 31403115 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)CNC(=O)c3ccc(C)s3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15-3-8-18(30-15)21(27)22-13-20(26)29-14-19(25)24-11-9-23(10-12-24)16-4-6-17(28-2)7-5-16/h3-8H,9-14H2,1-2H3,(H,22,27) |
| InChIKey | ZWZJNXBTZKEIOC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|