C15H20N2O4S — CID 35726305
(2-oxo-2-piperidin-1-ylethyl) 2-[(5-methylthiophene-2-carbonyl)amino]acetate (PubChem CID 35726305) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-[(5-methylthiophene-2-carbonyl)amino]acetate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 35726305 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCC(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C15H20N2O4S/c1-11-5-6-12(22-11)15(20)16-9-14(19)21-10-13(18)17-7-3-2-4-8-17/h5-6H,2-4,7-10H2,1H3,(H,16,20) |
| InChIKey | HFOOJQGLYYGGNP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |