C15H21N3O5S — CID 4036905
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate (PubChem CID 4036905) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 4036905 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCC(=O)NC(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C15H21N3O5S/c1-9-5-6-10(24-9)13(21)16-7-12(20)23-8-11(19)17-14(22)18-15(2,3)4/h5-6H,7-8H2,1-4H3,(H,16,21)(H2,17,18,19,22) |
| InChIKey | ZOASTVSBKUXZGO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |