C23H26N4O2S — CID 3140773
2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 3140773) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 3140773 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)C(C#N)=Cc1cc(C)n(-c2sc3c(c2C#N)CCCC3)c1C |
| InChI | InChI=1S/C23H26N4O2S/c1-15-11-17(12-18(13-24)22(28)26-9-6-10-29-3)16(2)27(15)23-20(14-25)19-7-4-5-8-21(19)30-23/h11-12H,4-10H2,1-3H3,(H,26,28) |
| InChIKey | HUBPGKDLCKJBRA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|