C17H17FN4O3 — CID 31431450
3-(4-fluorophenoxy)propyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 31431450) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 3-(4-fluorophenoxy)propyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 31431450 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(C)n2nc(C(=O)OCCCOc3ccc(F)cc3)nc2n1 |
| InChI | InChI=1S/C17H17FN4O3/c1-11-10-12(2)22-17(19-11)20-15(21-22)16(23)25-9-3-8-24-14-6-4-13(18)5-7-14/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | MTKOBZPYUSPEJZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|