C20H21FN2O5 — CID 31431476
3-(4-fluorophenoxy)propyl 3,5-diacetamidobenzoate (PubChem CID 31431476) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 3,5-diacetamidobenzoate.
| Compound Name | 3-(4-fluorophenoxy)propyl 3,5-diacetamidobenzoate |
|---|---|
| PubChem CID | 31431476 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 3,5-diacetamidobenzoate |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)OCCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2O5/c1-13(24)22-17-10-15(11-18(12-17)23-14(2)25)20(26)28-9-3-8-27-19-6-4-16(21)5-7-19/h4-7,10-12H,3,8-9H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | RGFDZPJEXNLYMD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|