C36H45NO14 — CID 171049984
3-O-[4-[4-[4-[4-(4-methoxybutoxy)-4-oxobutanoyl]oxybutoxycarbonyl]benzoyl]oxybutyl] 1-O-methyl 5-acetamidobenzene-1,3-dicarboxylate (PubChem CID 171049984) has the molecular formula C36H45NO14 and a molecular weight of 715.75 g/mol. Its IUPAC name is 3-O-[4-[4-[4-[4-(4-methoxybutoxy)-4-oxobutanoyl]oxybutoxycarbonyl]benzoyl]oxybutyl] 1-O-methyl 5-acetamidobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[4-[4-[4-[4-(4-methoxybutoxy)-4-oxobutanoyl]oxybutoxycarbonyl]benzoyl]oxybutyl] 1-O-methyl 5-acetamidobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 171049984 |
| Molecular Formula | C36H45NO14 |
| Molecular Weight | 715.75 g/mol |
| Exact Mass | 715.28 |
| IUPAC Name | 3-O-[4-[4-[4-[4-(4-methoxybutoxy)-4-oxobutanoyl]oxybutoxycarbonyl]benzoyl]oxybutyl] 1-O-methyl 5-acetamidobenzene-1,3-dicarboxylate |
| SMILES | COCCCCOC(=O)CCC(=O)OCCCCOC(=O)c1ccc(C(=O)OCCCCOC(=O)c2cc(NC(C)=O)cc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C36H45NO14/c1-25(38)37-30-23-28(33(41)46-3)22-29(24-30)36(44)51-21-9-8-20-50-35(43)27-12-10-26(11-13-27)34(42)49-19-7-6-18-48-32(40)15-14-31(39)47-17-5-4-16-45-2/h10-13,22-24H,4-9,14-21H2,1-3H3,(H,37,38) |
| InChIKey | QRLIQWWGXTZMGD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|