C21H23FN2O3 — CID 31443397
N-[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl]-4-ethoxybenzamide (PubChem CID 31443397) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl]-4-ethoxybenzamide.
| Compound Name | N-[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 31443397 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[2-[cyclopropyl-[(2-fluorophenyl)methyl]amino]-2-oxoethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N(Cc2ccccc2F)C2CC2)cc1 |
| InChI | InChI=1S/C21H23FN2O3/c1-2-27-18-11-7-15(8-12-18)21(26)23-13-20(25)24(17-9-10-17)14-16-5-3-4-6-19(16)22/h3-8,11-12,17H,2,9-10,13-14H2,1H3,(H,23,26) |
| InChIKey | IOBTUHOTKTVHRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |