C24H21FN2O3 — CID 56545378
4-[4-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]phenoxy]benzamide (PubChem CID 56545378) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-[4-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545378 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[4-[cyclopropyl-[(2-fluorophenyl)methyl]carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)N(Cc3ccccc3F)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C24H21FN2O3/c25-22-4-2-1-3-18(22)15-27(19-9-10-19)24(29)17-7-13-21(14-8-17)30-20-11-5-16(6-12-20)23(26)28/h1-8,11-14,19H,9-10,15H2,(H2,26,28) |
| InChIKey | BITMKMYZADRECR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |