C25H26ClNO7 — CID 3144952
6-[2-(2-chlorophenyl)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 3144952) has the molecular formula C25H26ClNO7 and a molecular weight of 487.94 g/mol. Its IUPAC name is 6-[2-(2-chlorophenyl)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[2-(2-chlorophenyl)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 3144952 |
| Molecular Formula | C25H26ClNO7 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 6-[2-(2-chlorophenyl)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCCCCC(=O)O)C2c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C25H26ClNO7/c1-33-18-12-11-15(14-19(18)34-2)23(30)21-22(16-8-5-6-9-17(16)26)27(25(32)24(21)31)13-7-3-4-10-20(28)29/h5-6,8-9,11-12,14,22,30H,3-4,7,10,13H2,1-2H3,(H,28,29) |
| InChIKey | LXDVLATUNZZWJF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|