C15H15FN2O2S — CID 31458228
N-[2-(4-fluoro-2-methylanilino)-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 31458228) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[2-(4-fluoro-2-methylanilino)-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-(4-fluoro-2-methylanilino)-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 31458228 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-(4-fluoro-2-methylanilino)-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(F)cc2C)s1 |
| InChI | InChI=1S/C15H15FN2O2S/c1-9-7-11(16)4-5-12(9)18-14(19)8-17-15(20)13-6-3-10(2)21-13/h3-7H,8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | MDOYQCOPTCQVPK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |