C15H13BrFNO3S — CID 18270512
(2-bromo-4-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate (PubChem CID 18270512) has the molecular formula C15H13BrFNO3S and a molecular weight of 386.24 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate.
| Compound Name | (2-bromo-4-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 18270512 |
| Molecular Formula | C15H13BrFNO3S |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | (2-bromo-4-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCc2ccc(F)cc2Br)s1 |
| InChI | InChI=1S/C15H13BrFNO3S/c1-9-2-5-13(22-9)15(20)18-7-14(19)21-8-10-3-4-11(17)6-12(10)16/h2-6H,7-8H2,1H3,(H,18,20) |
| InChIKey | FFMBWZGHMZFNPC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |