C30H38N2O4 — CID 3146122
1,4-bis[4-(3-phenoxypropoxy)but-2-ynyl]piperazine (PubChem CID 3146122) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 1,4-bis[4-(3-phenoxypropoxy)but-2-ynyl]piperazine.
| Compound Name | 1,4-bis[4-(3-phenoxypropoxy)but-2-ynyl]piperazine |
|---|---|
| PubChem CID | 3146122 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 1,4-bis[4-(3-phenoxypropoxy)but-2-ynyl]piperazine |
| SMILES | C(#CCN1CCN(CC#CCOCCCOc2ccccc2)CC1)COCCCOc1ccccc1 |
| InChI | InChI=1S/C30H38N2O4/c1-3-13-29(14-4-1)35-27-11-25-33-23-9-7-17-31-19-21-32(22-20-31)18-8-10-24-34-26-12-28-36-30-15-5-2-6-16-30/h1-6,13-16H,11-12,17-28H2 |
| InChIKey | SOEJOKUIKJFIMV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|