C21H34N4O — CID 31462183
(E)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 31462183) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is (E)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 31462183 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (E)-N-[(1-piperidin-1-ylcyclohexyl)methyl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C21H34N4O/c1-17-19(18(2)24(3)23-17)10-11-20(26)22-16-21(12-6-4-7-13-21)25-14-8-5-9-15-25/h10-11H,4-9,12-16H2,1-3H3,(H,22,26)/b11-10+ |
| InChIKey | IRZCSRHCRFDWEO-ZHACJKMWSA-N |
| XLogP | 3.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|