C16H16N2O6S2 — CID 3146253
2-[(4-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid (PubChem CID 3146253) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[(4-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(4-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3146253 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[(4-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1cc(S(=O)(=O)N2CCOCC2)cs1 |
| InChI | InChI=1S/C16H16N2O6S2/c19-15(17-13-4-2-1-3-12(13)16(20)21)14-9-11(10-25-14)26(22,23)18-5-7-24-8-6-18/h1-4,9-10H,5-8H2,(H,17,19)(H,20,21) |
| InChIKey | KJZCPGXHFAJIFV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |