C15H16N2O5S2 — CID 2471603
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(methanesulfonamido)benzoate (PubChem CID 2471603) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 2471603 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)OCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H16N2O5S2/c1-24(20,21)17-13-7-3-2-6-12(13)15(19)22-10-14(18)16-9-11-5-4-8-23-11/h2-8,17H,9-10H2,1H3,(H,16,18) |
| InChIKey | QXIOTJARALUHRD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |