C22H27N5O3S2 — CID 3147292
5-[[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3147292) has the molecular formula C22H27N5O3S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 5-[[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3147292 |
| Molecular Formula | C22H27N5O3S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 5-[[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1CCN(c2nc3c(C)cccn3c(=O)c2C=C2SC(=S)N(CCOC)C2=O)CC1 |
| InChI | InChI=1S/C22H27N5O3S2/c1-4-24-8-10-25(11-9-24)19-16(20(28)26-7-5-6-15(2)18(26)23-19)14-17-21(29)27(12-13-30-3)22(31)32-17/h5-7,14H,4,8-13H2,1-3H3 |
| InChIKey | YUKQSJHWCSILLZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|