C28H31N5O3S2 — CID 4593068
5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(3-methoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4593068) has the molecular formula C28H31N5O3S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(3-methoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(3-methoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4593068 |
| Molecular Formula | C28H31N5O3S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(3-methoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)C(=Cc2c(N3CCN(Cc4ccccc4)CC3)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C28H31N5O3S2/c1-20-8-6-11-32-24(20)29-25(31-15-13-30(14-16-31)19-21-9-4-3-5-10-21)22(26(32)34)18-23-27(35)33(28(37)38-23)12-7-17-36-2/h3-6,8-11,18H,7,12-17,19H2,1-2H3 |
| InChIKey | QCDVZYZPAOAAKX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|