C32H29N5O4S2 — CID 4628206
5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-benzyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4628206) has the molecular formula C32H29N5O4S2 and a molecular weight of 611.75 g/mol. Its IUPAC name is 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-benzyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-benzyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4628206 |
| Molecular Formula | C32H29N5O4S2 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 5-[[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-benzyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C=C3SC(=S)N(Cc4ccccc4)C3=O)c(N3CCN(Cc4ccc5c(c4)OCO5)CC3)nc12 |
| InChI | InChI=1S/C32H29N5O4S2/c1-21-6-5-11-36-28(21)33-29(35-14-12-34(13-15-35)18-23-9-10-25-26(16-23)41-20-40-25)24(30(36)38)17-27-31(39)37(32(42)43-27)19-22-7-3-2-4-8-22/h2-11,16-17H,12-15,18-20H2,1H3 |
| InChIKey | RBTXOIOHDLJUIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|