C33H30N4O4S2 — CID 5208743
3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(4-benzylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5208743) has the molecular formula C33H30N4O4S2 and a molecular weight of 610.76 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(4-benzylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(4-benzylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5208743 |
| Molecular Formula | C33H30N4O4S2 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(4-benzylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C=C3SC(=S)N(Cc4ccc5c(c4)OCO5)C3=O)c(N3CCC(Cc4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C33H30N4O4S2/c1-21-6-5-13-36-29(21)34-30(35-14-11-23(12-15-35)16-22-7-3-2-4-8-22)25(31(36)38)18-28-32(39)37(33(42)43-28)19-24-9-10-26-27(17-24)41-20-40-26/h2-10,13,17-18,23H,11-12,14-16,19-20H2,1H3 |
| InChIKey | LYBJYYWWDCQSAH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|