C26H24N4O4S2 — CID 4180038
3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(3-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4180038) has the molecular formula C26H24N4O4S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(3-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(3-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4180038 |
| Molecular Formula | C26H24N4O4S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(3-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1CCCN(c2nc3ccccn3c(=O)c2C=C2SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)C1 |
| InChI | InChI=1S/C26H24N4O4S2/c1-16-5-4-9-28(13-16)23-18(24(31)29-10-3-2-6-22(29)27-23)12-21-25(32)30(26(35)36-21)14-17-7-8-19-20(11-17)34-15-33-19/h2-3,6-8,10-12,16H,4-5,9,13-15H2,1H3 |
| InChIKey | BHUFZMNJPDMBMP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|