C25H22N4O5S2 — CID 87626720
(5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-[methyl(oxolan-2-yl)amino]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87626720) has the molecular formula C25H22N4O5S2 and a molecular weight of 522.61 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-[methyl(oxolan-2-yl)amino]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-[methyl(oxolan-2-yl)amino]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87626720 |
| Molecular Formula | C25H22N4O5S2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-[methyl(oxolan-2-yl)amino]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN(c1nc2ccccn2c(=O)c1/C=C1\SC(=S)N(Cc2ccc3c(c2)OCO3)C1=O)C1CCCO1 |
| InChI | InChI=1S/C25H22N4O5S2/c1-27(21-6-4-10-32-21)22-16(23(30)28-9-3-2-5-20(28)26-22)12-19-24(31)29(25(35)36-19)13-15-7-8-17-18(11-15)34-14-33-17/h2-3,5,7-9,11-12,21H,4,6,10,13-14H2,1H3/b19-12- |
| InChIKey | RDGFPNMQBVOGLT-UNOMPAQXSA-N |
| XLogP | 3.40 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|