C26H16FN3O5S2 — CID 18816834
(5E)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18816834) has the molecular formula C26H16FN3O5S2 and a molecular weight of 533.56 g/mol. Its IUPAC name is (5E)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18816834 |
| Molecular Formula | C26H16FN3O5S2 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | (5E)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[2-(2-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2c(Oc3ccccc3F)nc3ccccn3c2=O)SC(=S)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H16FN3O5S2/c27-17-5-1-2-6-18(17)35-23-16(24(31)29-10-4-3-7-22(29)28-23)12-21-25(32)30(26(36)37-21)13-15-8-9-19-20(11-15)34-14-33-19/h1-12H,13-14H2/b21-12+ |
| InChIKey | HKMHDTVTFJVVJR-CIAFOILYSA-N |
| XLogP | 4.76 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|