C21H24N4O3S2 — CID 93016961
(5E)-3-(2-methoxyethyl)-5-[[2-[(3S)-3-methylpiperidin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 93016961) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (5E)-3-(2-methoxyethyl)-5-[[2-[(3S)-3-methylpiperidin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-methoxyethyl)-5-[[2-[(3S)-3-methylpiperidin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 93016961 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (5E)-3-(2-methoxyethyl)-5-[[2-[(3S)-3-methylpiperidin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)/C(=C\c2c(N3CCC[C@H](C)C3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C21H24N4O3S2/c1-14-6-5-8-23(13-14)18-15(19(26)24-9-4-3-7-17(24)22-18)12-16-20(27)25(10-11-28-2)21(29)30-16/h3-4,7,9,12,14H,5-6,8,10-11,13H2,1-2H3/b16-12+/t14-/m0/s1 |
| InChIKey | UFOYOMRYYQWHCZ-AOHITCTBSA-N |
| XLogP | 2.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|