C28H31N5O2S2 — CID 98148294
(5E)-5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(2S)-butan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 98148294) has the molecular formula C28H31N5O2S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is (5E)-5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(2S)-butan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(2S)-butan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98148294 |
| Molecular Formula | C28H31N5O2S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (5E)-5-[[2-(4-benzylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(2S)-butan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC[C@H](C)N1C(=O)/C(=C\c2c(N3CCN(Cc4ccccc4)CC3)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C28H31N5O2S2/c1-4-20(3)33-27(35)23(37-28(33)36)17-22-25(29-24-19(2)9-8-12-32(24)26(22)34)31-15-13-30(14-16-31)18-21-10-6-5-7-11-21/h5-12,17,20H,4,13-16,18H2,1-3H3/b23-17+/t20-/m0/s1 |
| InChIKey | MHGNPHYTXKDBQN-UZXYXVAJSA-N |
| XLogP | 4.32 |
| TPSA | 61.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|