C22H27N2O3+ — CID 3149701
1-[4-[3-(3-ethyl-5,6-dimethylbenzimidazol-1-ium-1-yl)-2-hydroxypropoxy]phenyl]ethanone (PubChem CID 3149701) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[4-[3-(3-ethyl-5,6-dimethylbenzimidazol-1-ium-1-yl)-2-hydroxypropoxy]phenyl]ethanone.
| Compound Name | 1-[4-[3-(3-ethyl-5,6-dimethylbenzimidazol-1-ium-1-yl)-2-hydroxypropoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 3149701 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-[4-[3-(3-ethyl-5,6-dimethylbenzimidazol-1-ium-1-yl)-2-hydroxypropoxy]phenyl]ethanone |
| SMILES | CCn1c[n+](CC(O)COc2ccc(C(C)=O)cc2)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C22H27N2O3/c1-5-23-14-24(22-11-16(3)15(2)10-21(22)23)12-19(26)13-27-20-8-6-18(7-9-20)17(4)25/h6-11,14,19,26H,5,12-13H2,1-4H3/q+1 |
| InChIKey | VVNOQFWCYCDQMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|