C17H12F3NO — CID 3150841
1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone (PubChem CID 3150841) has the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. Its IUPAC name is 1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 3150841 |
| Molecular Formula | C17H12F3NO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(1-benzylindol-3-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cn(Cc2ccccc2)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H12F3NO/c18-17(19,20)16(22)14-11-21(10-12-6-2-1-3-7-12)15-9-5-4-8-13(14)15/h1-9,11H,10H2 |
| InChIKey | FLIPGOAKSVPLIH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |