C17H22ClNO3S — CID 3151135
ethyl 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxylate (PubChem CID 3151135) has the molecular formula C17H22ClNO3S and a molecular weight of 355.89 g/mol. Its IUPAC name is ethyl 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3151135 |
| Molecular Formula | C17H22ClNO3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | ethyl 1-[2-(4-chlorophenyl)sulfanylpropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22ClNO3S/c1-3-22-17(21)13-8-10-19(11-9-13)16(20)12(2)23-15-6-4-14(18)5-7-15/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | WEIFSHCLPPCJAG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |