C17H19ClN2O4S — CID 2822281
ethyl 1-[(E)-2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]piperidine-4-carboxylate (PubChem CID 2822281) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is ethyl 1-[(E)-2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(E)-2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2822281 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | ethyl 1-[(E)-2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C=C(\C#N)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H19ClN2O4S/c1-2-24-17(21)13-7-9-20(10-8-13)12-16(11-19)25(22,23)15-5-3-14(18)4-6-15/h3-6,12-13H,2,7-10H2,1H3/b16-12+ |
| InChIKey | RMLORZYTXBFCQN-FOWTUZBSSA-N |
| XLogP | 2.75 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|