C17H24ClNO2S — CID 6461142
ethyl 1-[3-(4-chlorophenyl)sulfanylpropyl]piperidine-4-carboxylate (PubChem CID 6461142) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is ethyl 1-[3-(4-chlorophenyl)sulfanylpropyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(4-chlorophenyl)sulfanylpropyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6461142 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl 1-[3-(4-chlorophenyl)sulfanylpropyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H24ClNO2S/c1-2-21-17(20)14-8-11-19(12-9-14)10-3-13-22-16-6-4-15(18)5-7-16/h4-7,14H,2-3,8-13H2,1H3 |
| InChIKey | KMHCWJDROUBKMS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|