C15H15N3O2 — CID 31535484
3-(4-ethoxyphenoxy)-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 31535484) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(4-ethoxyphenoxy)-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-(4-ethoxyphenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 31535484 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(4-ethoxyphenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | CCOc1ccc(Oc2nnc(C)c(C)c2C#N)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-4-19-12-5-7-13(8-6-12)20-15-14(9-16)10(2)11(3)17-18-15/h5-8H,4H2,1-3H3 |
| InChIKey | BWSFGAWIHMRFBK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |