C16H17ClN6 — CID 31537774
4-[[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 31537774) has the molecular formula C16H17ClN6 and a molecular weight of 328.81 g/mol. Its IUPAC name is 4-[[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 31537774 |
| Molecular Formula | C16H17ClN6 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(c3cc(Cl)nc(N)n3)CC2)cc1 |
| InChI | InChI=1S/C16H17ClN6/c17-14-9-15(21-16(19)20-14)23-7-5-22(6-8-23)11-13-3-1-12(10-18)2-4-13/h1-4,9H,5-8,11H2,(H2,19,20,21) |
| InChIKey | MJYWSQKMXFUBAW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |