C17H19N5O3 — CID 3154190
3-methyl-7-(2-phenoxyethyl)-8-(prop-2-enylamino)purine-2,6-dione (PubChem CID 3154190) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-methyl-7-(2-phenoxyethyl)-8-(prop-2-enylamino)purine-2,6-dione.
| Compound Name | 3-methyl-7-(2-phenoxyethyl)-8-(prop-2-enylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 3154190 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-methyl-7-(2-phenoxyethyl)-8-(prop-2-enylamino)purine-2,6-dione |
| SMILES | C=CCNc1nc2c(c(=O)[nH]c(=O)n2C)n1CCOc1ccccc1 |
| InChI | InChI=1S/C17H19N5O3/c1-3-9-18-16-19-14-13(15(23)20-17(24)21(14)2)22(16)10-11-25-12-7-5-4-6-8-12/h3-8H,1,9-11H2,2H3,(H,18,19)(H,20,23,24) |
| InChIKey | YTIKNPWFJZASCU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|