C16H25NO2 — CID 31556
1-Pentyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 31556) has the molecular formula C16H25NO2 and a molecular weight of 263.37 g/mol. Its IUPAC name is 6,7-dimethoxy-1-pentyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-Pentyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 31556 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 6,7-dimethoxy-1-pentyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCCCC1C2=CC(=C(C=C2CCN1)OC)OC |
| InChIKey | HEXJYLSBFSMHSC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 259 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|