C18H13ClN2O4 — CID 31601831
(4-cyanophenyl)methyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 31601831) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | (4-cyanophenyl)methyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 31601831 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | N#Cc1ccc(COC(=O)CN2C(=O)COc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C18H13ClN2O4/c19-14-5-6-16-15(7-14)21(17(22)11-24-16)9-18(23)25-10-13-3-1-12(8-20)2-4-13/h1-7H,9-11H2 |
| InChIKey | OLQSFAZNFOUAOL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |