C22H24N2O7 — CID 3161003
dimethyl 5-[(7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydro-1H-quinoline-4-carbonyl)amino]benzene-1,3-dicarboxylate (PubChem CID 3161003) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is dimethyl 5-[(7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydro-1H-quinoline-4-carbonyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydro-1H-quinoline-4-carbonyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3161003 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | dimethyl 5-[(7,7-dimethyl-2,5-dioxo-3,4,6,8-tetrahydro-1H-quinoline-4-carbonyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C2CC(=O)NC3=C2C(=O)CC(C)(C)C3)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H24N2O7/c1-22(2)9-15-18(16(25)10-22)14(8-17(26)24-15)19(27)23-13-6-11(20(28)30-3)5-12(7-13)21(29)31-4/h5-7,14H,8-10H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | GRHLNUWLKKOVSW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |