C18H17NO4S2 — CID 3162269
N-(5-ethylsulfonyl-2-methoxyphenyl)-1-benzothiophene-3-carboxamide (PubChem CID 3162269) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-methoxyphenyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-methoxyphenyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3162269 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-(5-ethylsulfonyl-2-methoxyphenyl)-1-benzothiophene-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(OC)c(NC(=O)c2csc3ccccc23)c1 |
| InChI | InChI=1S/C18H17NO4S2/c1-3-25(21,22)12-8-9-16(23-2)15(10-12)19-18(20)14-11-24-17-7-5-4-6-13(14)17/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | RYHOFIFAYBQDDU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |