C30H26N4O4S — CID 4216551
N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 4216551) has the molecular formula C30H26N4O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4216551 |
| Molecular Formula | C30H26N4O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(NC(=O)c2cc(-c3ccccn3)nc3ccccc23)c1 |
| InChI | InChI=1S/C30H26N4O4S/c1-3-34(21-11-5-4-6-12-21)39(36,37)22-16-17-29(38-2)28(19-22)33-30(35)24-20-27(26-15-9-10-18-31-26)32-25-14-8-7-13-23(24)25/h4-20H,3H2,1-2H3,(H,33,35) |
| InChIKey | FTDVMQYEOGLGKA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |