C27H26N4O5S — CID 16547973
1-benzyl-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-6-oxopyridazine-3-carboxamide (PubChem CID 16547973) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is 1-benzyl-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 16547973 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 1-benzyl-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(NC(=O)c2ccc(=O)n(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H26N4O5S/c1-3-31(21-12-8-5-9-13-21)37(34,35)22-14-16-25(36-2)24(18-22)28-27(33)23-15-17-26(32)30(29-23)19-20-10-6-4-7-11-20/h4-18H,3,19H2,1-2H3,(H,28,33) |
| InChIKey | KDTGSENZBJJMDU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |